CAS 1485424-72-3 is the registry number for (1S,4S)-2,5-Diazabicyclo[2.2.1]heptane-1-carboxylic acid dihydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S,4S)-2,5-diazabicyclo[2.2.1]heptane-1-carboxylic acid;dihydrochloride (CAS 1485424-72-3) is a chemical compound with the molecular formula C6H12Cl2N2O2 and a molecular weight of 215.07 g/mol. IUPAC name: (1S,4S)-2,5-diazabicyclo[2.2.1]heptane-1-carboxylic acid;dihydrochloride. InChIKey: IVCFPOOFOSVPDO-RHENCHDXSA-N.
| Molecular formula | C6H12Cl2N2O2 |
|---|---|
| Molecular weight | 215.07 g/mol |
| IUPAC name | (1S,4S)-2,5-diazabicyclo[2.2.1]heptane-1-carboxylic acid;dihydrochloride |
| InChIKey | IVCFPOOFOSVPDO-RHENCHDXSA-N |
| SMILES | C1[C@H]2CN[C@@]1(CN2)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)