Products 2361644-54-2
CAS 2361644-54-2 is the registry number for 5-Oxa-2,8-diazaspiro(3.5)nonan-7-one dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-oxa-2,8-diazaspiro[3.5]nonan-7-one;dihydrochloride (CAS 2361644-54-2) is a chemical compound with the molecular formula C6H12Cl2N2O2 and a molecular weight of 215.07 g/mol. IUPAC name: 5-oxa-2,8-diazaspiro[3.5]nonan-7-one;dihydrochloride. InChIKey: VCQLKNBVPLOMHV-UHFFFAOYSA-N.
| Molecular formula | C6H12Cl2N2O2 |
|---|---|
| Molecular weight | 215.07 g/mol |
| IUPAC name | 5-oxa-2,8-diazaspiro[3.5]nonan-7-one;dihydrochloride |
| InChIKey | VCQLKNBVPLOMHV-UHFFFAOYSA-N |
| SMILES | C1C(=O)NCC2(O1)CNC2.Cl.Cl |
Computed by PubChem (NCBI)