CAS 148547-33-5 appears in our catalog under these names: GR 125743, GR 125743, 98%, GR 125743/ 99.76% (existing batch purity), GR 125743, N-(4-Methoxy-3-(4-methylpiperazin-1-yl)phenyl)-3-methyl-4-(pyridin-4-yl)benzamide, 98%, 98%. Offered by: GLPBio, AmBeed, TargetMol, Biosynth, Chemat. Available pack sizes: 5mg, 100mg, 10mg, 10mM (in 1ml dmso), 25mg, 50mg, 1mg, 2mg.
N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methyl-4-pyridin-4-ylbenzamide (CAS 148547-33-5) is a chemical compound with the molecular formula C25H28N4O2 and a molecular weight of 416.5 g/mol. IUPAC name: N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methyl-4-pyridin-4-ylbenzamide. InChIKey: GNOXPYACARZYMW-UHFFFAOYSA-N.
| Molecular formula | C25H28N4O2 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | N-[4-methoxy-3-(4-methylpiperazin-1-yl)phenyl]-3-methyl-4-pyridin-4-ylbenzamide |
| InChIKey | GNOXPYACARZYMW-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(=O)NC2=CC(=C(C=C2)OC)N3CCN(CC3)C)C4=CC=NC=C4 |
Computed by PubChem (NCBI)