CAS 714265-50-6 appears in our catalog under these names: GPR88–IN–1, GPR88-IN-1, 99%, 99%, GPR88-IN-1, 99.17%, GPR88-IN-1, 98%. Offered by: GLPBio, Chemat, MedChemExpress, Ambeed. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 10 mg, 100 mg, 25 mg, 50 mg.
4-(2-benzylanilino)-2-(cyclohexylmethylamino)pyrimidine-5-carboxylic acid (CAS 714265-50-6) is a chemical compound with the molecular formula C25H28N4O2 and a molecular weight of 416.5 g/mol. IUPAC name: 4-(2-benzylanilino)-2-(cyclohexylmethylamino)pyrimidine-5-carboxylic acid. InChIKey: XZFTUBCGJFWCHL-UHFFFAOYSA-N.
| Molecular formula | C25H28N4O2 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | 4-(2-benzylanilino)-2-(cyclohexylmethylamino)pyrimidine-5-carboxylic acid |
| InChIKey | XZFTUBCGJFWCHL-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)CNC2=NC=C(C(=N2)NC3=CC=CC=C3CC4=CC=CC=C4)C(=O)O |
Computed by PubChem (NCBI)