CAS 1486-54-0 is the registry number for 3,4-Bis(benzyloxy)benzoyl Chloride. Offered by: TRC. Available pack sizes: 500mg.
3,4-bis(phenylmethoxy)benzoyl chloride (CAS 1486-54-0) is a chemical compound with the molecular formula C21H17ClO3 and a molecular weight of 352.8 g/mol. IUPAC name: 3,4-bis(phenylmethoxy)benzoyl chloride. InChIKey: ZLWMGDNHFWGWLW-UHFFFAOYSA-N.
| Molecular formula | C21H17ClO3 |
|---|---|
| Molecular weight | 352.8 g/mol |
| IUPAC name | 3,4-bis(phenylmethoxy)benzoyl chloride |
| InChIKey | ZLWMGDNHFWGWLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C(C=C(C=C2)C(=O)Cl)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)