CAS 204123-86-4 is the registry number for 4,4'-(Chloro(4-methoxyphenyl)ethenylidene)bis-phenol. Offered by: TRC. Available pack sizes: 100mg.
4-[2-chloro-1-(4-hydroxyphenyl)-2-(4-methoxyphenyl)ethenyl]phenol (CAS 204123-86-4) is a chemical compound with the molecular formula C21H17ClO3 and a molecular weight of 352.8 g/mol. IUPAC name: 4-[2-chloro-1-(4-hydroxyphenyl)-2-(4-methoxyphenyl)ethenyl]phenol. InChIKey: KUIIVJFWKJNNGP-UHFFFAOYSA-N.
| Molecular formula | C21H17ClO3 |
|---|---|
| Molecular weight | 352.8 g/mol |
| IUPAC name | 4-[2-chloro-1-(4-hydroxyphenyl)-2-(4-methoxyphenyl)ethenyl]phenol |
| InChIKey | KUIIVJFWKJNNGP-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=C(C2=CC=C(C=C2)O)C3=CC=C(C=C3)O)Cl |
Computed by PubChem (NCBI)