CAS 14860-89-0 appears in our catalog under these names: 2-(3-Iso-propylphenyl)-2-propanol, 95%, 2–(3–Isopropylphenyl)propan–2–ol, alpha,alpha-Dimethyl-3-isopropylbenzenemethanol. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 100mg.
2-(3-propan-2-ylphenyl)propan-2-ol (CAS 14860-89-0) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: 2-(3-propan-2-ylphenyl)propan-2-ol. InChIKey: GCFSLINNKUVOJH-UHFFFAOYSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | 2-(3-propan-2-ylphenyl)propan-2-ol |
| InChIKey | GCFSLINNKUVOJH-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC=C1)C(C)(C)O |
Computed by PubChem (NCBI)