Products 1879-09-0
CAS 1879-09-0 appears in our catalog under these names: 2-(tert-Butyl)-4,6-dimethylphenol, 98%, Oxymetazoline Impurity 5, 6-tert-Butyl-2,4-xylenol, 2-tert-Butyl-4,6-dimethylphenol, 6-tert-Butyl-2,4-dimethylphenol. Offered by: Combi-blocks, Chemat Brand, TRC, Dr. Ehrenstorfer, Mikromol. Available pack sizes: 100g, 1kg, 25g, 500g, 5g, on request, 100mg, 10g.
2-tert-butyl-4,6-dimethylphenol (CAS 1879-09-0) is a chemical compound with the molecular formula C12H18O and a molecular weight of 178.27 g/mol. IUPAC name: 2-tert-butyl-4,6-dimethylphenol. InChIKey: OPLCSTZDXXUYDU-UHFFFAOYSA-N.
| Molecular formula | C12H18O |
|---|---|
| Molecular weight | 178.27 g/mol |
| IUPAC name | 2-tert-butyl-4,6-dimethylphenol |
| InChIKey | OPLCSTZDXXUYDU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(C)(C)C)O)C |
Computed by PubChem (NCBI)