CAS 148651-39-2 is the registry number for 4-Bromophenylzinc iodide, 0.5M in THF, packaged under Argon . Offered by: Thermo Scientific (Alfa Aesar). Available pack sizes: 50ml.
Bromobenzene;iodozinc(1+) (CAS 148651-39-2) is a chemical compound with the molecular formula C6H4BrIZn and a molecular weight of 348.3 g/mol. IUPAC name: bromobenzene;iodozinc(1+). InChIKey: PLIIAGJFCAKUCV-UHFFFAOYSA-M.
| Molecular formula | C6H4BrIZn |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | bromobenzene;iodozinc(1+) |
| InChIKey | PLIIAGJFCAKUCV-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=[C-]1)Br.[Zn+]I |
Computed by PubChem (NCBI)