CAS 186000-44-2 is the registry number for 3–Bromophenylzinc iodide solution. Offered by: GLPBio. Available pack sizes: 50ml.
Bromobenzene;iodozinc(1+) (CAS 186000-44-2) is a chemical compound with the molecular formula C6H4BrIZn and a molecular weight of 348.3 g/mol. IUPAC name: bromobenzene;iodozinc(1+). InChIKey: GMLNDLKPSGCEDN-UHFFFAOYSA-M.
| Molecular formula | C6H4BrIZn |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | bromobenzene;iodozinc(1+) |
| InChIKey | GMLNDLKPSGCEDN-UHFFFAOYSA-M |
| SMILES | C1=C[C-]=CC(=C1)Br.[Zn+]I |
Computed by PubChem (NCBI)