CAS 1486571-48-5 is the registry number for 9-(Diphenylmethylene)-6,7-dimethoxy-1,4-dihydro-1,4-methanonaphthalene, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
11-benzhydrylidene-4,5-dimethoxytricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (CAS 1486571-48-5) is a chemical compound with the molecular formula C26H22O2 and a molecular weight of 366.4 g/mol. IUPAC name: 11-benzhydrylidene-4,5-dimethoxytricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene. InChIKey: HIAMVPDTIAFYEU-UHFFFAOYSA-N.
| Molecular formula | C26H22O2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 11-benzhydrylidene-4,5-dimethoxytricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| InChIKey | HIAMVPDTIAFYEU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C3C=CC(C2=C1)C3=C(C4=CC=CC=C4)C5=CC=CC=C5)OC |
Computed by PubChem (NCBI)