CAS 863643-48-5 is the registry number for 2,2'-(Pyrene-1,8-diylbis(ethyne-2,1-diyl))bis(propan-2-ol), 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[8-(3-hydroxy-3-methylbut-1-ynyl)pyren-1-yl]-2-methylbut-3-yn-2-ol (CAS 863643-48-5) is a chemical compound with the molecular formula C26H22O2 and a molecular weight of 366.4 g/mol. IUPAC name: 4-[8-(3-hydroxy-3-methylbut-1-ynyl)pyren-1-yl]-2-methylbut-3-yn-2-ol. InChIKey: IMZHGAUTOXQBMM-UHFFFAOYSA-N.
| Molecular formula | C26H22O2 |
|---|---|
| Molecular weight | 366.4 g/mol |
| IUPAC name | 4-[8-(3-hydroxy-3-methylbut-1-ynyl)pyren-1-yl]-2-methylbut-3-yn-2-ol |
| InChIKey | IMZHGAUTOXQBMM-UHFFFAOYSA-N |
| SMILES | CC(C)(C#CC1=C2C=CC3=C(C=CC4=C3C2=C(C=C4)C=C1)C#CC(C)(C)O)O |
Computed by PubChem (NCBI)