CAS 148672-09-7 appears in our catalog under these names: Estrone 3-O-Sulfamate, >95% (HPLC), Estrone 3–O–Sulfamate, Estrone O-sulfamate/ 99.86% (existing batch purity), Estrone 3-O-sulfamate, ESTRONE SULFAMATE. Offered by: TRC, GLPBio, TargetMol, Biosynth, Sigma-Aldrich. Available pack sizes: 1mg, 100mg, 10mg, 25mg, 50mg, 5mg, 2mg, .2MG.
[(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate (CAS 148672-09-7) is a chemical compound with the molecular formula C18H23NO4S and a molecular weight of 349.4 g/mol. IUPAC name: [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate. InChIKey: RVKFQAJIXCZXQY-CBZIJGRNSA-N.
| Molecular formula | C18H23NO4S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | [(8R,9S,13S,14S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl] sulfamate |
| InChIKey | RVKFQAJIXCZXQY-CBZIJGRNSA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CCC2=O)CCC4=C3C=CC(=C4)OS(=O)(=O)N |
Computed by PubChem (NCBI)