CAS 890708-64-2 is the registry number for 2-Methoxy-5-((2R)-2-(((1R)-1-phenylethyl)amino)propyl)benzenesulfonic Acid. Offered by: TRC. Available pack sizes: 500mg.
2-methoxy-5-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]benzenesulfonic acid (CAS 890708-64-2) is a chemical compound with the molecular formula C18H23NO4S and a molecular weight of 349.4 g/mol. IUPAC name: 2-methoxy-5-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]benzenesulfonic acid. InChIKey: QBGOTFZYXLKICE-ZIAGYGMSSA-N.
| Molecular formula | C18H23NO4S |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | 2-methoxy-5-[(2R)-2-[[(1R)-1-phenylethyl]amino]propyl]benzenesulfonic acid |
| InChIKey | QBGOTFZYXLKICE-ZIAGYGMSSA-N |
| SMILES | C[C@H](CC1=CC(=C(C=C1)OC)S(=O)(=O)O)N[C@H](C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)