Products 148706-09-6

CAS 148706-09-6 is the registry number for 6-Methoxy-4,4-dimethyl-6-oxohexanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-methoxy-4,4-dimethyl-6-oxohexanoic acid (CAS 148706-09-6) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: 6-methoxy-4,4-dimethyl-6-oxohexanoic acid. InChIKey: QLRQCDQMURIKQB-UHFFFAOYSA-N.

Identity
Molecular formulaC9H16O4
Molecular weight188.22 g/mol
IUPAC name6-methoxy-4,4-dimethyl-6-oxohexanoic acid
InChIKeyQLRQCDQMURIKQB-UHFFFAOYSA-N
SMILESCC(C)(CCC(=O)O)CC(=O)OC

Computed by PubChem (NCBI)