CAS 1487188-84-0 appears in our catalog under these names: 4-Bromo-2,2-dimethyl-2,3-dihydro-1H-indene, 95%, 4-Bromo-2,2-dimethyl-2,3-dihydro-1H-indene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-bromo-2,2-dimethyl-1,3-dihydroindene (CAS 1487188-84-0) is a chemical compound with the molecular formula C11H13Br and a molecular weight of 225.12 g/mol. IUPAC name: 4-bromo-2,2-dimethyl-1,3-dihydroindene. InChIKey: QVMDSCJJUXFOHN-UHFFFAOYSA-N.
| Molecular formula | C11H13Br |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 4-bromo-2,2-dimethyl-1,3-dihydroindene |
| InChIKey | QVMDSCJJUXFOHN-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C1)C(=CC=C2)Br)C |
Computed by PubChem (NCBI)