CAS 951891-96-6 is the registry number for 2-Bromo-3-(2,6-dimethylphenyl)-1-propene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2-bromoprop-2-enyl)-1,3-dimethylbenzene (CAS 951891-96-6) is a chemical compound with the molecular formula C11H13Br and a molecular weight of 225.12 g/mol. IUPAC name: 2-(2-bromoprop-2-enyl)-1,3-dimethylbenzene. InChIKey: CPKPIXXWBNLEIN-UHFFFAOYSA-N.
| Molecular formula | C11H13Br |
|---|---|
| Molecular weight | 225.12 g/mol |
| IUPAC name | 2-(2-bromoprop-2-enyl)-1,3-dimethylbenzene |
| InChIKey | CPKPIXXWBNLEIN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)CC(=C)Br |
Computed by PubChem (NCBI)