CAS 148874-68-4 appears in our catalog under these names: Methyl 5-fluoro-2,6-dihydroxynicotinate, 95%, Methyl 5–fluoro–2,6–dihydroxynicotinate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 1g, 250mg.
Methyl 5-fluoro-2-hydroxy-6-oxo-1H-pyridine-3-carboxylate (CAS 148874-68-4) is a chemical compound with the molecular formula C7H6FNO4 and a molecular weight of 187.12 g/mol. IUPAC name: methyl 5-fluoro-2-hydroxy-6-oxo-1H-pyridine-3-carboxylate. InChIKey: ZSFQAJJFUBORSF-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO4 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | methyl 5-fluoro-2-hydroxy-6-oxo-1H-pyridine-3-carboxylate |
| InChIKey | ZSFQAJJFUBORSF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(NC(=O)C(=C1)F)O |
Computed by PubChem (NCBI)