CAS 1823330-91-1 is the registry number for 2-Fluoro-4-hydroxy-5-nitrobenzyl alcohol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-fluoro-4-(hydroxymethyl)-2-nitrophenol (CAS 1823330-91-1) is a chemical compound with the molecular formula C7H6FNO4 and a molecular weight of 187.12 g/mol. IUPAC name: 5-fluoro-4-(hydroxymethyl)-2-nitrophenol. InChIKey: SUFGCMOAMOYWRZ-UHFFFAOYSA-N.
| Molecular formula | C7H6FNO4 |
|---|---|
| Molecular weight | 187.12 g/mol |
| IUPAC name | 5-fluoro-4-(hydroxymethyl)-2-nitrophenol |
| InChIKey | SUFGCMOAMOYWRZ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])O)F)CO |
Computed by PubChem (NCBI)