CAS 1488953-36-1 is the registry number for 2-Bromo-5-(3-(trifluoromethyl)phenoxy)-1,3,4-thiadiazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-5-[3-(trifluoromethyl)phenoxy]-1,3,4-thiadiazole (CAS 1488953-36-1) is a chemical compound with the molecular formula C9H4BrF3N2OS and a molecular weight of 325.11 g/mol. IUPAC name: 2-bromo-5-[3-(trifluoromethyl)phenoxy]-1,3,4-thiadiazole. InChIKey: YQHSDQOHBBWJFS-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF3N2OS |
|---|---|
| Molecular weight | 325.11 g/mol |
| IUPAC name | 2-bromo-5-[3-(trifluoromethyl)phenoxy]-1,3,4-thiadiazole |
| InChIKey | YQHSDQOHBBWJFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC2=NN=C(S2)Br)C(F)(F)F |
Computed by PubChem (NCBI)