CAS 532401-06-2 appears in our catalog under these names: 2-Bromo-5-(3-(trifluoromethoxy)phenyl)-1,3,4-thiadiazole, 2-Bromo-5-(3-(trifluoromethoxy)phenyl)-1,3,4-thiadiazole, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2-bromo-5-[3-(trifluoromethoxy)phenyl]-1,3,4-thiadiazole (CAS 532401-06-2) is a chemical compound with the molecular formula C9H4BrF3N2OS and a molecular weight of 325.11 g/mol. IUPAC name: 2-bromo-5-[3-(trifluoromethoxy)phenyl]-1,3,4-thiadiazole. InChIKey: JOGXPTMBVJKSLR-UHFFFAOYSA-N.
| Molecular formula | C9H4BrF3N2OS |
|---|---|
| Molecular weight | 325.11 g/mol |
| IUPAC name | 2-bromo-5-[3-(trifluoromethoxy)phenyl]-1,3,4-thiadiazole |
| InChIKey | JOGXPTMBVJKSLR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C2=NN=C(S2)Br |
Computed by PubChem (NCBI)