Products 1489233-24-0
CAS 1489233-24-0 is the registry number for tert-Butyl 7-acetyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 7-acetyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate (CAS 1489233-24-0) is a chemical compound with the molecular formula C14H24N2O3 and a molecular weight of 268.35 g/mol. IUPAC name: tert-butyl 7-acetyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate. InChIKey: BPAVIRPTUHYYOY-UHFFFAOYSA-N.
| Molecular formula | C14H24N2O3 |
|---|---|
| Molecular weight | 268.35 g/mol |
| IUPAC name | tert-butyl 7-acetyl-3,7-diazabicyclo[3.3.1]nonane-3-carboxylate |
| InChIKey | BPAVIRPTUHYYOY-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CC2CC(C1)CN(C2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)