Products 1489300-22-2
CAS 1489300-22-2 is the registry number for 1-(2-Chlorophenyl)-3-cyclopropyl-1H-pyrazole-5-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(2-chlorophenyl)-3-cyclopropylpyrazole-5-carboxylic acid (CAS 1489300-22-2) is a chemical compound with the molecular formula C13H11ClN2O2 and a molecular weight of 262.69 g/mol. IUPAC name: 1-(2-chlorophenyl)-3-cyclopropylpyrazole-5-carboxylic acid. InChIKey: ZCPBZWYDOMQKFE-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O2 |
|---|---|
| Molecular weight | 262.69 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-3-cyclopropylpyrazole-5-carboxylic acid |
| InChIKey | ZCPBZWYDOMQKFE-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NN(C(=C2)C(=O)O)C3=CC=CC=C3Cl |
Computed by PubChem (NCBI)