CAS 1490-44-4 appears in our catalog under these names: 3-Chloro-6-phenoxypyridazine, 96%, 3-Chloro-6-phenoxypyridazine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 10g, 25g, 1g.
3-chloro-6-phenoxypyridazine (CAS 1490-44-4) is a chemical compound with the molecular formula C10H7ClN2O and a molecular weight of 206.63 g/mol. IUPAC name: 3-chloro-6-phenoxypyridazine. InChIKey: VPVVMGVIGYPNDM-UHFFFAOYSA-N.
| Molecular formula | C10H7ClN2O |
|---|---|
| Molecular weight | 206.63 g/mol |
| IUPAC name | 3-chloro-6-phenoxypyridazine |
| InChIKey | VPVVMGVIGYPNDM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)