CAS 149054-39-7 appears in our catalog under these names: 2-(4-Bromophenyl)-1,10-phenanthroline, >95.0%(T)(HPLC), 2-(4-Bromophenyl)-1,10-phenanthroline, 95.0%, 95.0%. Offered by: TCI, Chemat. Available pack sizes: 1g.
2-(4-bromophenyl)-1,10-phenanthroline (CAS 149054-39-7) is a chemical compound with the molecular formula C18H11BrN2 and a molecular weight of 335.2 g/mol. IUPAC name: 2-(4-bromophenyl)-1,10-phenanthroline. InChIKey: OATGRTIOGXDQQF-UHFFFAOYSA-N.
| Molecular formula | C18H11BrN2 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | 2-(4-bromophenyl)-1,10-phenanthroline |
| InChIKey | OATGRTIOGXDQQF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=C2)C=CC(=N3)C4=CC=C(C=C4)Br)N=C1 |
Computed by PubChem (NCBI)