CAS 2044705-99-7 is the registry number for 1-Bromo-11,12-dihydroindolo[2,3-a]carbazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-11,12-dihydroindolo[2,3-a]carbazole (CAS 2044705-99-7) is a chemical compound with the molecular formula C18H11BrN2 and a molecular weight of 335.2 g/mol. IUPAC name: 1-bromo-11,12-dihydroindolo[2,3-a]carbazole. InChIKey: YFNSECPNQCEBRA-UHFFFAOYSA-N.
| Molecular formula | C18H11BrN2 |
|---|---|
| Molecular weight | 335.2 g/mol |
| IUPAC name | 1-bromo-11,12-dihydroindolo[2,3-a]carbazole |
| InChIKey | YFNSECPNQCEBRA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(N2)C4=C(C=C3)C5=C(N4)C(=CC=C5)Br |
Computed by PubChem (NCBI)