CAS 149054-53-5 appears in our catalog under these names: (Z)-Fenpyroximate, (Z)-Fenpyroximate 100 µg/mL in Acetonitrile. Offered by: Chemat Brand, Dr. Ehrenstorfer. Available pack sizes: on request, 1ml.
Tert-butyl 4-[[(Z)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoate (CAS 149054-53-5) is a chemical compound with the molecular formula C24H27N3O4 and a molecular weight of 421.5 g/mol. IUPAC name: tert-butyl 4-[[(Z)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoate. InChIKey: YYJNOYZRYGDPNH-MYYYXRDXSA-N.
| Molecular formula | C24H27N3O4 |
|---|---|
| Molecular weight | 421.5 g/mol |
| IUPAC name | tert-butyl 4-[[(Z)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoate |
| InChIKey | YYJNOYZRYGDPNH-MYYYXRDXSA-N |
| SMILES | CC1=NN(C(=C1/C=N\OCC2=CC=C(C=C2)C(=O)OC(C)(C)C)OC3=CC=CC=C3)C |
Computed by PubChem (NCBI)