CAS 14906-97-9 is the registry number for D-Gluconic acid, sodium salt, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Sodium gluconate is an organic sodium salt having D-gluconate as the counterion. It has a role as a chelator. It contains a D-gluconate.
Source: ChEBI
| Molecular formula | C6H11NaO7 |
|---|---|
| Molecular weight | 218.14 g/mol |
| IUPAC name | sodium (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChIKey | UPMFZISCCZSDND-JJKGCWMISA-M |
| SMILES | C([C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O)O)O.[Na+] |
Computed by PubChem (NCBI)