CAS 6451-20-3 is the registry number for Gulonic Acid Sodium Salt. Offered by: TRC. Available pack sizes: 100mg.
Sodium (2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoate (CAS 6451-20-3) is a chemical compound with the molecular formula C6H11NaO7 and a molecular weight of 218.14 g/mol. IUPAC name: sodium (2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoate. InChIKey: UPMFZISCCZSDND-BZWNWTOPSA-M.
| Molecular formula | C6H11NaO7 |
|---|---|
| Molecular weight | 218.14 g/mol |
| IUPAC name | sodium (2R,3R,4S,5R)-2,3,4,5,6-pentahydroxyhexanoate |
| InChIKey | UPMFZISCCZSDND-BZWNWTOPSA-M |
| SMILES | C([C@H]([C@@H]([C@H]([C@H](C(=O)[O-])O)O)O)O)O.[Na+] |
Computed by PubChem (NCBI)