CAS 1491026-40-4 is the registry number for (2R,3S,4R)-2-[(benzoyloxy)methyl]-4-cyano-4-methyl-5-oxooxolan-3-yl benzoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,3S,4R)-3-benzoyloxy-4-cyano-4-methyl-5-oxooxolan-2-yl]methyl benzoate (CAS 1491026-40-4) is a chemical compound with the molecular formula C21H17NO6 and a molecular weight of 379.4 g/mol. IUPAC name: [(2R,3S,4R)-3-benzoyloxy-4-cyano-4-methyl-5-oxooxolan-2-yl]methyl benzoate. InChIKey: XTRWWLBHMYBZKJ-CBGDNZLLSA-N.
| Molecular formula | C21H17NO6 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | [(2R,3S,4R)-3-benzoyloxy-4-cyano-4-methyl-5-oxooxolan-2-yl]methyl benzoate |
| InChIKey | XTRWWLBHMYBZKJ-CBGDNZLLSA-N |
| SMILES | C[C@]1([C@@H]([C@H](OC1=O)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)C#N |
Computed by PubChem (NCBI)