Products 923288-55-5
CAS 923288-55-5 is the registry number for 3,4-Bis(benzyloxy)-5-nitrobenzoic acid. Offered by: Biosynth. Available pack sizes: 500g, 1000g.
3-nitro-4,5-bis(phenylmethoxy)benzoic acid (CAS 923288-55-5) is a chemical compound with the molecular formula C21H17NO6 and a molecular weight of 379.4 g/mol. IUPAC name: 3-nitro-4,5-bis(phenylmethoxy)benzoic acid. InChIKey: OAMQLXQTSMBAGG-UHFFFAOYSA-N.
| Molecular formula | C21H17NO6 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 3-nitro-4,5-bis(phenylmethoxy)benzoic acid |
| InChIKey | OAMQLXQTSMBAGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC(=CC(=C2OCC3=CC=CC=C3)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)