Products 1491129-84-0
CAS 1491129-84-0 is the registry number for Methyl (R)-3-(4,6-dichloropyrimidin-5-yl)butanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (3R)-3-(4,6-dichloropyrimidin-5-yl)butanoate (CAS 1491129-84-0) is a chemical compound with the molecular formula C9H10Cl2N2O2 and a molecular weight of 249.09 g/mol. IUPAC name: methyl (3R)-3-(4,6-dichloropyrimidin-5-yl)butanoate. InChIKey: BKTSPYPORGPMQE-RXMQYKEDSA-N.
| Molecular formula | C9H10Cl2N2O2 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | methyl (3R)-3-(4,6-dichloropyrimidin-5-yl)butanoate |
| InChIKey | BKTSPYPORGPMQE-RXMQYKEDSA-N |
| SMILES | C[C@H](CC(=O)OC)C1=C(N=CN=C1Cl)Cl |
Computed by PubChem (NCBI)