CAS 15253-89-1 appears in our catalog under these names: 2-(2,4-Dichlorophenoxy)propionic acid hydrazide, 95%, 2-(2,4-Dichlorophenoxy)propanohydrazide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 5g, 1g, 10000mg.
2-(2,4-dichlorophenoxy)propanehydrazide (CAS 15253-89-1) is a chemical compound with the molecular formula C9H10Cl2N2O2 and a molecular weight of 249.09 g/mol. IUPAC name: 2-(2,4-dichlorophenoxy)propanehydrazide. InChIKey: ZASHHUFHMQDNNE-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2N2O2 |
|---|---|
| Molecular weight | 249.09 g/mol |
| IUPAC name | 2-(2,4-dichlorophenoxy)propanehydrazide |
| InChIKey | ZASHHUFHMQDNNE-UHFFFAOYSA-N |
| SMILES | CC(C(=O)NN)OC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)