CAS 149143-68-0 is the registry number for Gimeracil Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-4-hydroxy-2-oxo-1H-pyridine-3-carbonitrile (CAS 149143-68-0) is a chemical compound with the molecular formula C6H3ClN2O2 and a molecular weight of 170.55 g/mol. IUPAC name: 5-chloro-4-hydroxy-2-oxo-1H-pyridine-3-carbonitrile. InChIKey: YEJKRSYPWZWFER-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O2 |
|---|---|
| Molecular weight | 170.55 g/mol |
| IUPAC name | 5-chloro-4-hydroxy-2-oxo-1H-pyridine-3-carbonitrile |
| InChIKey | YEJKRSYPWZWFER-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=O)N1)C#N)O)Cl |
Computed by PubChem (NCBI)