CAS 17348-69-5 is the registry number for 5-Chlorobenzofuroxan, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
5-chloro-1-oxido-2,1,3-benzoxadiazol-1-ium (CAS 17348-69-5) is a chemical compound with the molecular formula C6H3ClN2O2 and a molecular weight of 170.55 g/mol. IUPAC name: 5-chloro-1-oxido-2,1,3-benzoxadiazol-1-ium. InChIKey: DHPQXIQZZCNOLI-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN2O2 |
|---|---|
| Molecular weight | 170.55 g/mol |
| IUPAC name | 5-chloro-1-oxido-2,1,3-benzoxadiazol-1-ium |
| InChIKey | DHPQXIQZZCNOLI-UHFFFAOYSA-N |
| SMILES | C1=CC2=[N+](ON=C2C=C1Cl)[O-] |
Computed by PubChem (NCBI)