CAS 1491499-01-4 appears in our catalog under these names: 2-Chloro-7-methyl-6,7-dihydro-5H-cyclopenta(b)pyridine-3-carbonitrile, 95%, 2-Chloro-7-methyl-6,7-dihydro-5H-cyclopenta(b)pyridine-3-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile (CAS 1491499-01-4) is a chemical compound with the molecular formula C10H9ClN2 and a molecular weight of 192.64 g/mol. IUPAC name: 2-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile. InChIKey: BVVLIEYWQFGIMC-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2 |
|---|---|
| Molecular weight | 192.64 g/mol |
| IUPAC name | 2-chloro-7-methyl-6,7-dihydro-5H-cyclopenta[b]pyridine-3-carbonitrile |
| InChIKey | BVVLIEYWQFGIMC-UHFFFAOYSA-N |
| SMILES | CC1CCC2=CC(=C(N=C12)Cl)C#N |
Computed by PubChem (NCBI)