CAS 1491506-27-4 is the registry number for 4-Amino-N,1-diethyl-N-methyl-1H-pyrazole-3-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-N,1-diethyl-N-methylpyrazole-3-carboxamide (CAS 1491506-27-4) is a chemical compound with the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. IUPAC name: 4-amino-N,1-diethyl-N-methylpyrazole-3-carboxamide. InChIKey: AJYGQIFVCKBSQW-UHFFFAOYSA-N.
| Molecular formula | C9H16N4O |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | 4-amino-N,1-diethyl-N-methylpyrazole-3-carboxamide |
| InChIKey | AJYGQIFVCKBSQW-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C(=O)N(C)CC)N |
Computed by PubChem (NCBI)