Products 2765088-42-2
CAS 2765088-42-2 is the registry number for N-(5-Amino-1-methyl-1H-pyrazol-3-yl)pivalamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-amino-1-methylpyrazol-3-yl)-2,2-dimethylpropanamide (CAS 2765088-42-2) is a chemical compound with the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. IUPAC name: N-(5-amino-1-methylpyrazol-3-yl)-2,2-dimethylpropanamide. InChIKey: ULQKAHDGCHLQRK-UHFFFAOYSA-N.
| Molecular formula | C9H16N4O |
|---|---|
| Molecular weight | 196.25 g/mol |
| IUPAC name | N-(5-amino-1-methylpyrazol-3-yl)-2,2-dimethylpropanamide |
| InChIKey | ULQKAHDGCHLQRK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NC1=NN(C(=C1)N)C |
Computed by PubChem (NCBI)