CAS 14919-85-8 is the registry number for 1-(4-Chlorophenyl)-2-(ethylamino)-1-propanone-d5. Offered by: Biosynth. Available pack sizes: 10mg, 5mg, 25mg, 50mg.
1-(4-chlorophenyl)-2-(ethylamino)propan-1-one (CAS 14919-85-8) is a chemical compound with the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. IUPAC name: 1-(4-chlorophenyl)-2-(ethylamino)propan-1-one. InChIKey: RNBCGEIZCHBTGL-UHFFFAOYSA-N.
| Molecular formula | C11H14ClNO |
|---|---|
| Molecular weight | 211.69 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2-(ethylamino)propan-1-one |
| InChIKey | RNBCGEIZCHBTGL-UHFFFAOYSA-N |
| SMILES | CCNC(C)C(=O)C1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)