CAS 14926-29-5 is the registry number for 3′,6′-Bis(acetyloxy)-5-nitrospiro[isobenzofuran-1(3H),9′-[9H]xanthen]-3-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(6'-acetyloxy-5-nitro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (CAS 14926-29-5) is a chemical compound with the molecular formula C24H15NO9 and a molecular weight of 461.4 g/mol. IUPAC name: (6'-acetyloxy-5-nitro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate. InChIKey: BQPPOWMXCZRFHE-UHFFFAOYSA-N.
| Molecular formula | C24H15NO9 |
|---|---|
| Molecular weight | 461.4 g/mol |
| IUPAC name | (6'-acetyloxy-5-nitro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChIKey | BQPPOWMXCZRFHE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)[N+](=O)[O-])C(=O)O3)C5=C(O2)C=C(C=C5)OC(=O)C |
Computed by PubChem (NCBI)