CAS 53299-21-1 appears in our catalog under these names: 6-Nitrofluorescein Diacetate, 6-Nitrofluorescein diacetate, 98%, 98%. Offered by: TRC, Chemat. Available pack sizes: 2,5g, 25g, 500mg.
(6'-acetyloxy-6-nitro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate (CAS 53299-21-1) is a chemical compound with the molecular formula C24H15NO9 and a molecular weight of 461.4 g/mol. IUPAC name: (6'-acetyloxy-6-nitro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate. InChIKey: VYIGESZPYCCIHE-UHFFFAOYSA-N.
| Molecular formula | C24H15NO9 |
|---|---|
| Molecular weight | 461.4 g/mol |
| IUPAC name | (6'-acetyloxy-6-nitro-3-oxospiro[2-benzofuran-1,9'-xanthene]-3'-yl) acetate |
| InChIKey | VYIGESZPYCCIHE-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C3(C4=C(O2)C=C(C=C4)OC(=O)C)C5=C(C=CC(=C5)[N+](=O)[O-])C(=O)O3 |
Computed by PubChem (NCBI)