Products 1492854-15-5
CAS 1492854-15-5 is the registry number for 1-(Aminomethyl)-3-(trifluoromethyl)cyclohexan-1-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
1-(aminomethyl)-3-(trifluoromethyl)cyclohexan-1-ol (CAS 1492854-15-5) is a chemical compound with the molecular formula C8H14F3NO and a molecular weight of 197.20 g/mol. IUPAC name: 1-(aminomethyl)-3-(trifluoromethyl)cyclohexan-1-ol. InChIKey: LBZPPFQFWUNZAQ-UHFFFAOYSA-N.
| Molecular formula | C8H14F3NO |
|---|---|
| Molecular weight | 197.20 g/mol |
| IUPAC name | 1-(aminomethyl)-3-(trifluoromethyl)cyclohexan-1-ol |
| InChIKey | LBZPPFQFWUNZAQ-UHFFFAOYSA-N |
| SMILES | C1CC(CC(C1)(CN)O)C(F)(F)F |
Computed by PubChem (NCBI)