CAS 1803610-13-0 appears in our catalog under these names: 2,2,6-Trimethyl-6-(trifluoromethyl)morpholine, 95%, 2,2,6-Trimethyl-6-(trifluoromethyl)morpholine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,2,6-trimethyl-6-(trifluoromethyl)morpholine (CAS 1803610-13-0) is a chemical compound with the molecular formula C8H14F3NO and a molecular weight of 197.20 g/mol. IUPAC name: 2,2,6-trimethyl-6-(trifluoromethyl)morpholine. InChIKey: XXXPQHCXUSSDHK-UHFFFAOYSA-N.
| Molecular formula | C8H14F3NO |
|---|---|
| Molecular weight | 197.20 g/mol |
| IUPAC name | 2,2,6-trimethyl-6-(trifluoromethyl)morpholine |
| InChIKey | XXXPQHCXUSSDHK-UHFFFAOYSA-N |
| SMILES | CC1(CNCC(O1)(C)C(F)(F)F)C |
Computed by PubChem (NCBI)