CAS 1492905-11-9 is the registry number for 2-Bromo-3-fluoro-N,N-bis(1-methylethyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide (CAS 1492905-11-9) is a chemical compound with the molecular formula C13H17BrFNO and a molecular weight of 302.18 g/mol. IUPAC name: 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide. InChIKey: YZJWJKCTIAWPHR-UHFFFAOYSA-N.
| Molecular formula | C13H17BrFNO |
|---|---|
| Molecular weight | 302.18 g/mol |
| IUPAC name | 2-bromo-3-fluoro-N,N-di(propan-2-yl)benzamide |
| InChIKey | YZJWJKCTIAWPHR-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=C(C(=CC=C1)F)Br |
Computed by PubChem (NCBI)