CAS 951884-15-4 is the registry number for N, N-Diisopropyl 2-bromo-5-fluorobenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-5-fluoro-N,N-di(propan-2-yl)benzamide (CAS 951884-15-4) is a chemical compound with the molecular formula C13H17BrFNO and a molecular weight of 302.18 g/mol. IUPAC name: 2-bromo-5-fluoro-N,N-di(propan-2-yl)benzamide. InChIKey: XQHRWTNPRMQUQX-UHFFFAOYSA-N.
| Molecular formula | C13H17BrFNO |
|---|---|
| Molecular weight | 302.18 g/mol |
| IUPAC name | 2-bromo-5-fluoro-N,N-di(propan-2-yl)benzamide |
| InChIKey | XQHRWTNPRMQUQX-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(C)C)C(=O)C1=C(C=CC(=C1)F)Br |
Computed by PubChem (NCBI)