CAS 1492929-78-8 is the registry number for 5-Oxo-1-(3,3,3-trifluoropropyl)pyrrolidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-oxo-1-(3,3,3-trifluoropropyl)pyrrolidine-2-carboxylic acid (CAS 1492929-78-8) is a chemical compound with the molecular formula C8H10F3NO3 and a molecular weight of 225.16 g/mol. IUPAC name: 5-oxo-1-(3,3,3-trifluoropropyl)pyrrolidine-2-carboxylic acid. InChIKey: SWGBHZPQINZWGV-UHFFFAOYSA-N.
| Molecular formula | C8H10F3NO3 |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | 5-oxo-1-(3,3,3-trifluoropropyl)pyrrolidine-2-carboxylic acid |
| InChIKey | SWGBHZPQINZWGV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1C(=O)O)CCC(F)(F)F |
Computed by PubChem (NCBI)