CAS 1818847-38-9 appears in our catalog under these names: 2-Azaspiro[3.3]heptan-6-one trifluoroacetate, 95%, 2-azaspiro[3.3]heptan-6-one trifluoroacetate, 98%, 98%, 2-azaspiro[3.3]heptan-6-one, 2,2,2-trifluoroacetic acid, 97%, 2-Azaspiro[3.3]heptan-6-one 2,2,2-trifluoroacetate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 100mg, 500mg.
2-azaspiro[3.3]heptan-6-one;2,2,2-trifluoroacetic acid (CAS 1818847-38-9) is a chemical compound with the molecular formula C8H10F3NO3 and a molecular weight of 225.16 g/mol. IUPAC name: 2-azaspiro[3.3]heptan-6-one;2,2,2-trifluoroacetic acid. InChIKey: VJFPYVXEDCMULJ-UHFFFAOYSA-N.
| Molecular formula | C8H10F3NO3 |
|---|---|
| Molecular weight | 225.16 g/mol |
| IUPAC name | 2-azaspiro[3.3]heptan-6-one;2,2,2-trifluoroacetic acid |
| InChIKey | VJFPYVXEDCMULJ-UHFFFAOYSA-N |
| SMILES | C1C(=O)CC12CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)