CAS 1493-27-2 appears in our catalog under these names: 2-Fluoronitrobenzene, Olanzapine Impurity 2, 1–Fluoro–2–nitrobenzene, 2-Fluoronitrobenzene, >98.0%(GC), 1-Fluoro-2-nitrobenzene, 99% . Offered by: Biosynth, Chemat Brand, GLPBio, TCI, Thermo Scientific (Alfa Aesar). Available pack sizes: 500g, on request, 25g, 100g, 1000g, 50g, 250g, 10ML.
1-fluoro-2-nitrobenzene (CAS 1493-27-2) is a chemical compound with the molecular formula C6H4FNO2 and a molecular weight of 141.10 g/mol. IUPAC name: 1-fluoro-2-nitrobenzene. InChIKey: PWKNBLFSJAVFAB-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO2 |
|---|---|
| Molecular weight | 141.10 g/mol |
| IUPAC name | 1-fluoro-2-nitrobenzene |
| InChIKey | PWKNBLFSJAVFAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)