CAS 350-46-9 appears in our catalog under these names: 4-Fluoronitrobenzene, 98%, Nintedanib Impurity 67, 4-Nitrofluorobenzene, 4-Fluoronitrobenzene, 1–Fluoro–4–nitrobenzene. Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, GLPBio. Available pack sizes: 500g, 100g, 1kg, 25g, on request, 50mg, 2500g, 5G.
1-fluoro-4-nitrobenzene (CAS 350-46-9) is a chemical compound with the molecular formula C6H4FNO2 and a molecular weight of 141.10 g/mol. IUPAC name: 1-fluoro-4-nitrobenzene. InChIKey: WFQDTOYDVUWQMS-UHFFFAOYSA-N.
| Molecular formula | C6H4FNO2 |
|---|---|
| Molecular weight | 141.10 g/mol |
| IUPAC name | 1-fluoro-4-nitrobenzene |
| InChIKey | WFQDTOYDVUWQMS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])F |
Computed by PubChem (NCBI)