CAS 149354-10-9 appears in our catalog under these names: tert-Butyl 7-hydroxy-4,5-dihydro-1H-benzo(d)azepine-3(2H)-carboxylate, 98%, tert-Butyl 7-hydroxy-2,3,4,5-tetrahydro-1H-3-benzazepine-3-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 50mg, 100mg, 250mg, 500mg, 1000mg.
Tert-butyl 7-hydroxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate (CAS 149354-10-9) is a chemical compound with the molecular formula C15H21NO3 and a molecular weight of 263.33 g/mol. IUPAC name: tert-butyl 7-hydroxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate. InChIKey: CUVFQINKSGIQML-UHFFFAOYSA-N.
| Molecular formula | C15H21NO3 |
|---|---|
| Molecular weight | 263.33 g/mol |
| IUPAC name | tert-butyl 7-hydroxy-1,2,4,5-tetrahydro-3-benzazepine-3-carboxylate |
| InChIKey | CUVFQINKSGIQML-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(CC1)C=C(C=C2)O |
Computed by PubChem (NCBI)